C19H27N5OS — CID 17455387
2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 17455387) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17455387 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CC(C)(C)c1nc(SCC(=O)Nc2ccc(N3CCCCC3)cc2)n[nH]1 |
| InChI | InChI=1S/C19H27N5OS/c1-19(2,3)17-21-18(23-22-17)26-13-16(25)20-14-7-9-15(10-8-14)24-11-5-4-6-12-24/h7-10H,4-6,11-13H2,1-3H3,(H,20,25)(H,21,22,23) |
| InChIKey | SBCSIYUJCIPRDN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|