C21H25N5OS2 — CID 16607597
N-[4-(azepan-1-yl)phenyl]-2-[[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 16607597) has the molecular formula C21H25N5OS2 and a molecular weight of 427.60 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-2-[[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-2-[[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16607597 |
| Molecular Formula | C21H25N5OS2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-2-[[5-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(Cc2cccs2)n1)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H25N5OS2/c27-20(15-29-21-23-19(24-25-21)14-18-6-5-13-28-18)22-16-7-9-17(10-8-16)26-11-3-1-2-4-12-26/h5-10,13H,1-4,11-12,14-15H2,(H,22,27)(H,23,24,25) |
| InChIKey | HMMDDUWNQJTXRM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|