C16H20N4OS2 — CID 3574156
2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 3574156) has the molecular formula C16H20N4OS2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 3574156 |
| Molecular Formula | C16H20N4OS2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | Cc1nnc(SCC(=O)Nc2ccc(N3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C16H20N4OS2/c1-12-18-19-16(23-12)22-11-15(21)17-13-5-7-14(8-6-13)20-9-3-2-4-10-20/h5-8H,2-4,9-11H2,1H3,(H,17,21) |
| InChIKey | SDJRJDLQBGRTKU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|