C19H26N4OS3 — CID 7894523
2-[[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 7894523) has the molecular formula C19H26N4OS3 and a molecular weight of 422.65 g/mol. Its IUPAC name is 2-[[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7894523 |
| Molecular Formula | C19H26N4OS3 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CC(C)CSc1nnc(SCC(=O)Nc2ccc(N3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C19H26N4OS3/c1-14(2)12-25-18-21-22-19(27-18)26-13-17(24)20-15-6-8-16(9-7-15)23-10-4-3-5-11-23/h6-9,14H,3-5,10-13H2,1-2H3,(H,20,24) |
| InChIKey | BUMDMKWYPUTMNP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|