C26H30N4OS — CID 43936741
2-[6-(4-piperidin-1-ylphenyl)pyridazin-3-yl]sulfanyl-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 43936741) has the molecular formula C26H30N4OS and a molecular weight of 446.62 g/mol. Its IUPAC name is 2-[6-(4-piperidin-1-ylphenyl)pyridazin-3-yl]sulfanyl-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[6-(4-piperidin-1-ylphenyl)pyridazin-3-yl]sulfanyl-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43936741 |
| Molecular Formula | C26H30N4OS |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-[6-(4-piperidin-1-ylphenyl)pyridazin-3-yl]sulfanyl-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)CSc2ccc(-c3ccc(N4CCCCC4)cc3)nn2)cc1 |
| InChI | InChI=1S/C26H30N4OS/c1-19(2)20-6-10-22(11-7-20)27-25(31)18-32-26-15-14-24(28-29-26)21-8-12-23(13-9-21)30-16-4-3-5-17-30/h6-15,19H,3-5,16-18H2,1-2H3,(H,27,31) |
| InChIKey | FGKJUDBIDVUIHN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |