C25H31N5O — CID 42874354
1-[5-methyl-3-(4-piperidin-1-ylphenyl)-1H-pyrazol-4-yl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 42874354) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 1-[5-methyl-3-(4-piperidin-1-ylphenyl)-1H-pyrazol-4-yl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[5-methyl-3-(4-piperidin-1-ylphenyl)-1H-pyrazol-4-yl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 42874354 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 1-[5-methyl-3-(4-piperidin-1-ylphenyl)-1H-pyrazol-4-yl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | Cc1[nH]nc(-c2ccc(N3CCCCC3)cc2)c1NC(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C25H31N5O/c1-17(2)19-7-11-21(12-8-19)26-25(31)27-23-18(3)28-29-24(23)20-9-13-22(14-10-20)30-15-5-4-6-16-30/h7-14,17H,4-6,15-16H2,1-3H3,(H,28,29)(H2,26,27,31) |
| InChIKey | GYFSZGPATOCAFE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |