C23H24F3N5O — CID 42687416
1-[5-methyl-3-(4-piperidin-1-ylphenyl)-1H-pyrazol-4-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 42687416) has the molecular formula C23H24F3N5O and a molecular weight of 443.47 g/mol. Its IUPAC name is 1-[5-methyl-3-(4-piperidin-1-ylphenyl)-1H-pyrazol-4-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-methyl-3-(4-piperidin-1-ylphenyl)-1H-pyrazol-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42687416 |
| Molecular Formula | C23H24F3N5O |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 1-[5-methyl-3-(4-piperidin-1-ylphenyl)-1H-pyrazol-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1[nH]nc(-c2ccc(N3CCCCC3)cc2)c1NC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H24F3N5O/c1-15-20(28-22(32)27-18-9-7-17(8-10-18)23(24,25)26)21(30-29-15)16-5-11-19(12-6-16)31-13-3-2-4-14-31/h5-12H,2-4,13-14H2,1H3,(H,29,30)(H2,27,28,32) |
| InChIKey | XFTUEDRHMZGCGZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |