C25H25F3N4O — CID 2809988
1-[4-(4-benzylpiperazin-1-yl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 2809988) has the molecular formula C25H25F3N4O and a molecular weight of 454.50 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 2809988 |
| Molecular Formula | C25H25F3N4O |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H25F3N4O/c26-25(27,28)20-6-8-21(9-7-20)29-24(33)30-22-10-12-23(13-11-22)32-16-14-31(15-17-32)18-19-4-2-1-3-5-19/h1-13H,14-18H2,(H2,29,30,33) |
| InChIKey | QSSMCMBVUJVRFG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|