C30H27F3N4O — CID 91268853
N-[4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 91268853) has the molecular formula C30H27F3N4O and a molecular weight of 516.57 g/mol. Its IUPAC name is N-[4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 91268853 |
| Molecular Formula | C30H27F3N4O |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | N-[4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccncc3)CC2)cc1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H27F3N4O/c31-30(32,33)24-7-5-23(6-8-24)27-3-1-2-4-28(27)29(38)35-25-9-11-26(12-10-25)37-19-17-36(18-20-37)21-22-13-15-34-16-14-22/h1-16H,17-21H2,(H,35,38) |
| InChIKey | GJXIKTGETKJPJC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|