C31H28F3N3O — CID 160823841
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-phenyl-5-(trifluoromethyl)benzamide (PubChem CID 160823841) has the molecular formula C31H28F3N3O and a molecular weight of 515.58 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-phenyl-5-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-phenyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 160823841 |
| Molecular Formula | C31H28F3N3O |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-phenyl-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1)c1cc(C(F)(F)F)ccc1-c1ccccc1 |
| InChI | InChI=1S/C31H28F3N3O/c32-31(33,34)25-11-16-28(24-9-5-2-6-10-24)29(21-25)30(38)35-26-12-14-27(15-13-26)37-19-17-36(18-20-37)22-23-7-3-1-4-8-23/h1-16,21H,17-20,22H2,(H,35,38) |
| InChIKey | SFWZCFDBWCWEID-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|