C27H27F4N3O3 — CID 45480770
N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 45480770) has the molecular formula C27H27F4N3O3 and a molecular weight of 517.52 g/mol. Its IUPAC name is N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45480770 |
| Molecular Formula | C27H27F4N3O3 |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccc(N2CCCN(Cc3cccc(F)c3)CC2)cc1)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26FN3O.C2HF3O2/c26-22-9-4-6-20(18-22)19-28-14-5-15-29(17-16-28)24-12-10-23(11-13-24)27-25(30)21-7-2-1-3-8-21;3-2(4,5)1(6)7/h1-4,6-13,18H,5,14-17,19H2,(H,27,30);(H,6,7) |
| InChIKey | CVEVQSYEKOZHBE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|