C25H25F2N3O — CID 44528282
4-fluoro-N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]benzamide (PubChem CID 44528282) has the molecular formula C25H25F2N3O and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-fluoro-N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 44528282 |
| Molecular Formula | C25H25F2N3O |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-fluoro-N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCN(Cc3cccc(F)c3)CC2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25F2N3O/c26-21-7-5-20(6-8-21)25(31)28-23-9-11-24(12-10-23)30-14-2-13-29(15-16-30)18-19-3-1-4-22(27)17-19/h1,3-12,17H,2,13-16,18H2,(H,28,31) |
| InChIKey | GJTNYRGTOFWUIX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|