C25H25F4N3O3S — CID 45481216
N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 45481216) has the molecular formula C25H25F4N3O3S and a molecular weight of 523.55 g/mol. Its IUPAC name is N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45481216 |
| Molecular Formula | C25H25F4N3O3S |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-[4-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccc(N2CCCN(Cc3cccc(F)c3)CC2)cc1)c1cccs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H24FN3OS.C2HF3O2/c24-19-5-1-4-18(16-19)17-26-11-3-12-27(14-13-26)21-9-7-20(8-10-21)25-23(28)22-6-2-15-29-22;3-2(4,5)1(6)7/h1-2,4-10,15-16H,3,11-14,17H2,(H,25,28);(H,6,7) |
| InChIKey | SWNRZJPQKIMTHG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|