C23H30F3N3O3S — CID 45480809
N-[4-[4-(2-methylbutyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 45480809) has the molecular formula C23H30F3N3O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[4-[4-(2-methylbutyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[4-(2-methylbutyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45480809 |
| Molecular Formula | C23H30F3N3O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[4-[4-(2-methylbutyl)-1,4-diazepan-1-yl]phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCC(C)CN1CCCN(c2ccc(NC(=O)c3cccs3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H29N3OS.C2HF3O2/c1-3-17(2)16-23-11-5-12-24(14-13-23)19-9-7-18(8-10-19)22-21(25)20-6-4-15-26-20;3-2(4,5)1(6)7/h4,6-10,15,17H,3,5,11-14,16H2,1-2H3,(H,22,25);(H,6,7) |
| InChIKey | FRXLDIMIQDEECK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|