C27H31N3O4 — CID 42313354
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2,4,5-trimethoxybenzamide (PubChem CID 42313354) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 42313354 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)cc1OC |
| InChI | InChI=1S/C27H31N3O4/c1-32-24-18-26(34-3)25(33-2)17-23(24)27(31)28-21-9-11-22(12-10-21)30-15-13-29(14-16-30)19-20-7-5-4-6-8-20/h4-12,17-18H,13-16,19H2,1-3H3,(H,28,31) |
| InChIKey | ZXKVMMCYTQWBCL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|