C28H33N3O3 — CID 42313246
N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,4-diethoxybenzamide (PubChem CID 42313246) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,4-diethoxybenzamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 42313246 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)cc1OCC |
| InChI | InChI=1S/C28H33N3O3/c1-3-33-26-15-10-23(20-27(26)34-4-2)28(32)29-24-11-13-25(14-12-24)31-18-16-30(17-19-31)21-22-8-6-5-7-9-22/h5-15,20H,3-4,16-19,21H2,1-2H3,(H,29,32) |
| InChIKey | JGSGUBVCLKGLMV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|