C32H32ClN3O3 — CID 3810040
N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide (PubChem CID 3810040) has the molecular formula C32H32ClN3O3 and a molecular weight of 542.08 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide |
|---|---|
| PubChem CID | 3810040 |
| Molecular Formula | C32H32ClN3O3 |
| Molecular Weight | 542.08 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H32ClN3O3/c1-38-31-21-26(9-16-30(31)39-23-25-7-10-27(33)11-8-25)32(37)34-28-12-14-29(15-13-28)36-19-17-35(18-20-36)22-24-5-3-2-4-6-24/h2-16,21H,17-20,22-23H2,1H3,(H,34,37) |
| InChIKey | ARVVXLHBKVNWOA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.08 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|