C27H29ClN4O3S — CID 3553455
4-[(4-chlorophenyl)methoxy]-3-methoxy-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3553455) has the molecular formula C27H29ClN4O3S and a molecular weight of 525.07 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-3-methoxy-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-3-methoxy-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3553455 |
| Molecular Formula | C27H29ClN4O3S |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-3-methoxy-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(N3CCN(C)CC3)cc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H29ClN4O3S/c1-31-13-15-32(16-14-31)23-10-8-22(9-11-23)29-27(36)30-26(33)20-5-12-24(25(17-20)34-2)35-18-19-3-6-21(28)7-4-19/h3-12,17H,13-16,18H2,1-2H3,(H2,29,30,33,36) |
| InChIKey | PCAUNWHVLMDEEO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|