C31H24Cl2F5N3O3 — CID 3340594
N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide (PubChem CID 3340594) has the molecular formula C31H24Cl2F5N3O3 and a molecular weight of 652.45 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide.
| Compound Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide |
|---|---|
| PubChem CID | 3340594 |
| Molecular Formula | C31H24Cl2F5N3O3 |
| Molecular Weight | 652.45 g/mol |
| Exact Mass | 651.11 |
| IUPAC Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCN(c4c(F)c(F)c(F)c(F)c4F)CC3)c(Cl)c2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H24Cl2F5N3O3/c1-43-24-14-18(4-9-23(24)44-16-17-2-5-19(32)6-3-17)31(42)39-20-7-8-22(21(33)15-20)40-10-12-41(13-11-40)30-28(37)26(35)25(34)27(36)29(30)38/h2-9,14-15H,10-13,16H2,1H3,(H,39,42) |
| InChIKey | KEQKQMFARKLQDW-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.45 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|