C23H12ClF10N3O — CID 5003074
N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 5003074) has the molecular formula C23H12ClF10N3O and a molecular weight of 571.80 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 5003074 |
| Molecular Formula | C23H12ClF10N3O |
| Molecular Weight | 571.80 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c(Cl)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H12ClF10N3O/c24-9-7-8(35-23(38)11-12(25)14(27)16(29)15(28)13(11)26)1-2-10(9)36-3-5-37(6-4-36)22-20(33)18(31)17(30)19(32)21(22)34/h1-2,7H,3-6H2,(H,35,38) |
| InChIKey | PYGANBAZPDABDY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.80 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|