C23H16ClF5N4O3 — CID 3342665
N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-3-nitrobenzamide (PubChem CID 3342665) has the molecular formula C23H16ClF5N4O3 and a molecular weight of 526.85 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-3-nitrobenzamide.
| Compound Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3342665 |
| Molecular Formula | C23H16ClF5N4O3 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c(Cl)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16ClF5N4O3/c24-15-11-13(30-23(34)12-2-1-3-14(10-12)33(35)36)4-5-16(15)31-6-8-32(9-7-31)22-20(28)18(26)17(25)19(27)21(22)29/h1-5,10-11H,6-9H2,(H,30,34) |
| InChIKey | OYKYLLCUGTVLEW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|