C18H16ClN5O5S — CID 4262022
N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-3-nitrobenzamide (PubChem CID 4262022) has the molecular formula C18H16ClN5O5S and a molecular weight of 449.88 g/mol. Its IUPAC name is N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-3-nitrobenzamide.
| Compound Name | N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4262022 |
| Molecular Formula | C18H16ClN5O5S |
| Molecular Weight | 449.88 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-3-nitrobenzamide |
| SMILES | O=C(NC(=S)N1CCN(c2ccc([N+](=O)[O-])cc2Cl)CC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16ClN5O5S/c19-15-11-14(24(28)29)4-5-16(15)21-6-8-22(9-7-21)18(30)20-17(25)12-2-1-3-13(10-12)23(26)27/h1-5,10-11H,6-9H2,(H,20,25,30) |
| InChIKey | KUBCCNSIKLKVEE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|