C19H19ClN4O4S — CID 2898493
N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-2-phenoxyacetamide (PubChem CID 2898493) has the molecular formula C19H19ClN4O4S and a molecular weight of 434.91 g/mol. Its IUPAC name is N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-2-phenoxyacetamide.
| Compound Name | N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 2898493 |
| Molecular Formula | C19H19ClN4O4S |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(=S)N1CCN(c2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C19H19ClN4O4S/c20-16-12-14(24(26)27)6-7-17(16)22-8-10-23(11-9-22)19(29)21-18(25)13-28-15-4-2-1-3-5-15/h1-7,12H,8-11,13H2,(H,21,25,29) |
| InChIKey | NWZUQUYYPWNOFX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|