C15H17N5O3S — CID 54788370
N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-nitrobenzamide (PubChem CID 54788370) has the molecular formula C15H17N5O3S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-nitrobenzamide.
| Compound Name | N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 54788370 |
| Molecular Formula | C15H17N5O3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-nitrobenzamide |
| SMILES | N#CCCN1CCN(C(=S)NC(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C15H17N5O3S/c16-5-2-6-18-7-9-19(10-8-18)15(24)17-14(21)12-3-1-4-13(11-12)20(22)23/h1,3-4,11H,2,6-10H2,(H,17,21,24) |
| InChIKey | YQWOOHJSNNHRAQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|