C15H17ClN4OS — CID 54788356
3-chloro-N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]benzamide (PubChem CID 54788356) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is 3-chloro-N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]benzamide.
| Compound Name | 3-chloro-N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 54788356 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-chloro-N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]benzamide |
| SMILES | N#CCCN1CCN(C(=S)NC(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H17ClN4OS/c16-13-4-1-3-12(11-13)14(21)18-15(22)20-9-7-19(8-10-20)6-2-5-17/h1,3-4,11H,2,6-10H2,(H,18,21,22) |
| InChIKey | WTHUTBIYSMLOMO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|