C18H23BrN4O3S — CID 54788266
3-bromo-N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 54788266) has the molecular formula C18H23BrN4O3S and a molecular weight of 455.38 g/mol. Its IUPAC name is 3-bromo-N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | 3-bromo-N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 54788266 |
| Molecular Formula | C18H23BrN4O3S |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 3-bromo-N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)N2CCN(CCC#N)CC2)cc1Br |
| InChI | InChI=1S/C18H23BrN4O3S/c1-25-11-12-26-16-4-3-14(13-15(16)19)17(24)21-18(27)23-9-7-22(8-10-23)6-2-5-20/h3-4,13H,2,6-12H2,1H3,(H,21,24,27) |
| InChIKey | YIFQGKQPABDZOG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|