C18H24N4O2S — CID 54788357
N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-propoxybenzamide (PubChem CID 54788357) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-propoxybenzamide.
| Compound Name | N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-propoxybenzamide |
|---|---|
| PubChem CID | 54788357 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)NC(=S)N2CCN(CCC#N)CC2)c1 |
| InChI | InChI=1S/C18H24N4O2S/c1-2-13-24-16-6-3-5-15(14-16)17(23)20-18(25)22-11-9-21(10-12-22)8-4-7-19/h3,5-6,14H,2,4,8-13H2,1H3,(H,20,23,25) |
| InChIKey | ZALCGCUOIMEOET-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|