C27H29N3O2S — CID 17174821
N-(4-benzylpiperazine-1-carbothioyl)-3-(2-phenylethoxy)benzamide (PubChem CID 17174821) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is N-(4-benzylpiperazine-1-carbothioyl)-3-(2-phenylethoxy)benzamide.
| Compound Name | N-(4-benzylpiperazine-1-carbothioyl)-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17174821 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-(4-benzylpiperazine-1-carbothioyl)-3-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)N1CCN(Cc2ccccc2)CC1)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C27H29N3O2S/c31-26(24-12-7-13-25(20-24)32-19-14-22-8-3-1-4-9-22)28-27(33)30-17-15-29(16-18-30)21-23-10-5-2-6-11-23/h1-13,20H,14-19,21H2,(H,28,31,33) |
| InChIKey | DXEDRMRPJBJVSJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|