C24H24N2O2S — CID 17134568
N-[benzyl(methyl)carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 17134568) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[benzyl(methyl)carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[benzyl(methyl)carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17134568 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[benzyl(methyl)carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | CN(Cc1ccccc1)C(=S)NC(=O)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N2O2S/c1-26(18-20-11-6-3-7-12-20)24(29)25-23(27)21-13-8-14-22(17-21)28-16-15-19-9-4-2-5-10-19/h2-14,17H,15-16,18H2,1H3,(H,25,27,29) |
| InChIKey | WYGLXWYHXLPCRN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|