C28H30N2O5S — CID 43910849
ethyl 3-[benzyl-[[3-(2-phenoxyethoxy)benzoyl]carbamothioyl]amino]propanoate (PubChem CID 43910849) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is ethyl 3-[benzyl-[[3-(2-phenoxyethoxy)benzoyl]carbamothioyl]amino]propanoate.
| Compound Name | ethyl 3-[benzyl-[[3-(2-phenoxyethoxy)benzoyl]carbamothioyl]amino]propanoate |
|---|---|
| PubChem CID | 43910849 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | ethyl 3-[benzyl-[[3-(2-phenoxyethoxy)benzoyl]carbamothioyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C28H30N2O5S/c1-2-33-26(31)16-17-30(21-22-10-5-3-6-11-22)28(36)29-27(32)23-12-9-15-25(20-23)35-19-18-34-24-13-7-4-8-14-24/h3-15,20H,2,16-19,21H2,1H3,(H,29,32,36) |
| InChIKey | SYYZHYTURQFJFZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|