C23H28N2O6S — CID 43910798
ethyl 3-[benzyl-[(3,4,5-trimethoxybenzoyl)carbamothioyl]amino]propanoate (PubChem CID 43910798) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is ethyl 3-[benzyl-[(3,4,5-trimethoxybenzoyl)carbamothioyl]amino]propanoate.
| Compound Name | ethyl 3-[benzyl-[(3,4,5-trimethoxybenzoyl)carbamothioyl]amino]propanoate |
|---|---|
| PubChem CID | 43910798 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | ethyl 3-[benzyl-[(3,4,5-trimethoxybenzoyl)carbamothioyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)C(=S)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O6S/c1-5-31-20(26)11-12-25(15-16-9-7-6-8-10-16)23(32)24-22(27)17-13-18(28-2)21(30-4)19(14-17)29-3/h6-10,13-14H,5,11-12,15H2,1-4H3,(H,24,27,32) |
| InChIKey | NXINTERVWXZSDI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|