C23H26Cl2N2O4S — CID 43910799
ethyl 3-[benzyl-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]amino]propanoate (PubChem CID 43910799) has the molecular formula C23H26Cl2N2O4S and a molecular weight of 497.44 g/mol. Its IUPAC name is ethyl 3-[benzyl-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]amino]propanoate.
| Compound Name | ethyl 3-[benzyl-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]amino]propanoate |
|---|---|
| PubChem CID | 43910799 |
| Molecular Formula | C23H26Cl2N2O4S |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | ethyl 3-[benzyl-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)C(=S)NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H26Cl2N2O4S/c1-2-30-22(29)12-13-27(16-17-7-4-3-5-8-17)23(32)26-21(28)9-6-14-31-20-11-10-18(24)15-19(20)25/h3-5,7-8,10-11,15H,2,6,9,12-14,16H2,1H3,(H,26,28,32) |
| InChIKey | SQBTYCYCFRAANQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|