C20H20Cl2N2O2 — CID 43911644
N-benzyl-N-(2-cyanoethyl)-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 43911644) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is N-benzyl-N-(2-cyanoethyl)-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-benzyl-N-(2-cyanoethyl)-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 43911644 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-benzyl-N-(2-cyanoethyl)-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | N#CCCN(Cc1ccccc1)C(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl2N2O2/c21-17-9-10-19(18(22)14-17)26-13-4-8-20(25)24(12-5-11-23)15-16-6-2-1-3-7-16/h1-3,6-7,9-10,14H,4-5,8,12-13,15H2 |
| InChIKey | JECRFHYDESBNGK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|