C20H21Cl2NO4 — CID 52576373
methyl 4-[[4-(2,4-dichlorophenoxy)butanoyl-methylamino]methyl]benzoate (PubChem CID 52576373) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is methyl 4-[[4-(2,4-dichlorophenoxy)butanoyl-methylamino]methyl]benzoate.
| Compound Name | methyl 4-[[4-(2,4-dichlorophenoxy)butanoyl-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 52576373 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | methyl 4-[[4-(2,4-dichlorophenoxy)butanoyl-methylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C)C(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2NO4/c1-23(13-14-5-7-15(8-6-14)20(25)26-2)19(24)4-3-11-27-18-10-9-16(21)12-17(18)22/h5-10,12H,3-4,11,13H2,1-2H3 |
| InChIKey | BWNCIXODSFHIJX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|