C19H19Cl2NO4 — CID 55372070
N-(1,3-benzodioxol-5-ylmethyl)-4-(2,4-dichlorophenoxy)-N-methylbutanamide (PubChem CID 55372070) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-(2,4-dichlorophenoxy)-N-methylbutanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(2,4-dichlorophenoxy)-N-methylbutanamide |
|---|---|
| PubChem CID | 55372070 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(2,4-dichlorophenoxy)-N-methylbutanamide |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2NO4/c1-22(11-13-4-6-17-18(9-13)26-12-25-17)19(23)3-2-8-24-16-7-5-14(20)10-15(16)21/h4-7,9-10H,2-3,8,11-12H2,1H3 |
| InChIKey | SWBNXSMPSWGSGV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|