C18H27Cl2NO2 — CID 4181980
N,N-di(butan-2-yl)-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 4181980) has the molecular formula C18H27Cl2NO2 and a molecular weight of 360.33 g/mol. Its IUPAC name is N,N-di(butan-2-yl)-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N,N-di(butan-2-yl)-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 4181980 |
| Molecular Formula | C18H27Cl2NO2 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N,N-di(butan-2-yl)-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | CCC(C)N(C(=O)CCCOc1ccc(Cl)cc1Cl)C(C)CC |
| InChI | InChI=1S/C18H27Cl2NO2/c1-5-13(3)21(14(4)6-2)18(22)8-7-11-23-17-10-9-15(19)12-16(17)20/h9-10,12-14H,5-8,11H2,1-4H3 |
| InChIKey | KVHQHHIQBDLBDX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|