C17H23Cl2NO4 — CID 112791614
methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-3-methylpentanoate (PubChem CID 112791614) has the molecular formula C17H23Cl2NO4 and a molecular weight of 376.28 g/mol. Its IUPAC name is methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-3-methylpentanoate.
| Compound Name | methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 112791614 |
| Molecular Formula | C17H23Cl2NO4 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | methyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)CCCOc1ccc(Cl)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C17H23Cl2NO4/c1-4-11(2)16(17(22)23-3)20-15(21)6-5-9-24-14-8-7-12(18)10-13(14)19/h7-8,10-11,16H,4-6,9H2,1-3H3,(H,20,21) |
| InChIKey | GPNKFTIMRATQFM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|