C25H28Cl4N4O6 — CID 3689924
1-N',5-N'-bis[4-(2,4-dichlorophenoxy)butanoyl]pentanedihydrazide (PubChem CID 3689924) has the molecular formula C25H28Cl4N4O6 and a molecular weight of 622.33 g/mol. Its IUPAC name is 1-N',5-N'-bis[4-(2,4-dichlorophenoxy)butanoyl]pentanedihydrazide.
| Compound Name | 1-N',5-N'-bis[4-(2,4-dichlorophenoxy)butanoyl]pentanedihydrazide |
|---|---|
| PubChem CID | 3689924 |
| Molecular Formula | C25H28Cl4N4O6 |
| Molecular Weight | 622.33 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | 1-N',5-N'-bis[4-(2,4-dichlorophenoxy)butanoyl]pentanedihydrazide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)CCCC(=O)NNC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H28Cl4N4O6/c26-16-8-10-20(18(28)14-16)38-12-2-6-24(36)32-30-22(34)4-1-5-23(35)31-33-25(37)7-3-13-39-21-11-9-17(27)15-19(21)29/h8-11,14-15H,1-7,12-13H2,(H,30,34)(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | HLUZYXWFAZDAKW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|