C18H15BrCl4N2O4 — CID 17096549
N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-4-(2,4-dichlorophenoxy)butanehydrazide (PubChem CID 17096549) has the molecular formula C18H15BrCl4N2O4 and a molecular weight of 545.04 g/mol. Its IUPAC name is N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-4-(2,4-dichlorophenoxy)butanehydrazide.
| Compound Name | N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-4-(2,4-dichlorophenoxy)butanehydrazide |
|---|---|
| PubChem CID | 17096549 |
| Molecular Formula | C18H15BrCl4N2O4 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 541.90 |
| IUPAC Name | N'-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-4-(2,4-dichlorophenoxy)butanehydrazide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)COc1c(Cl)cc(Cl)cc1Br |
| InChI | InChI=1S/C18H15BrCl4N2O4/c19-12-6-11(21)8-14(23)18(12)29-9-17(27)25-24-16(26)2-1-5-28-15-4-3-10(20)7-13(15)22/h3-4,6-8H,1-2,5,9H2,(H,24,26)(H,25,27) |
| InChIKey | HBCWWKYUVRFIEO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|