C19H21Cl2N3O5S — CID 24538199
4-[3-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide (PubChem CID 24538199) has the molecular formula C19H21Cl2N3O5S and a molecular weight of 474.37 g/mol. Its IUPAC name is 4-[3-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | 4-[3-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24538199 |
| Molecular Formula | C19H21Cl2N3O5S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 4-[3-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCC(=O)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2N3O5S/c20-14-6-9-17(16(21)12-14)29-11-1-2-18(25)23-24-19(26)10-5-13-3-7-15(8-4-13)30(22,27)28/h3-4,6-9,12H,1-2,5,10-11H2,(H,23,25)(H,24,26)(H2,22,27,28) |
| InChIKey | OLIFPLXQDOHEBD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|