C22H24Cl2N2O5 — CID 4946981
2-phenylethyl 4-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-4-oxobutanoate (PubChem CID 4946981) has the molecular formula C22H24Cl2N2O5 and a molecular weight of 467.35 g/mol. Its IUPAC name is 2-phenylethyl 4-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 4946981 |
| Molecular Formula | C22H24Cl2N2O5 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2-phenylethyl 4-[2-[4-(2,4-dichlorophenoxy)butanoyl]hydrazinyl]-4-oxobutanoate |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)CCC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C22H24Cl2N2O5/c23-17-8-9-19(18(24)15-17)30-13-4-7-20(27)25-26-21(28)10-11-22(29)31-14-12-16-5-2-1-3-6-16/h1-3,5-6,8-9,15H,4,7,10-14H2,(H,25,27)(H,26,28) |
| InChIKey | ZEKHHKAGFGAWHF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|