C22H25Cl2NO4 — CID 25365035
[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 25365035) has the molecular formula C22H25Cl2NO4 and a molecular weight of 438.35 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 25365035 |
| Molecular Formula | C22H25Cl2NO4 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)COC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H25Cl2NO4/c1-16(9-10-17-6-3-2-4-7-17)25-21(26)15-29-22(27)8-5-13-28-20-12-11-18(23)14-19(20)24/h2-4,6-7,11-12,14,16H,5,8-10,13,15H2,1H3,(H,25,26)/t16-/m1/s1 |
| InChIKey | WXPAEWSWQBDSDT-MRXNPFEDSA-N |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|