C23H26Cl4N2O4 — CID 3619651
4-(2,4-dichlorophenoxy)-N-[2-[4-(2,4-dichlorophenoxy)butanoylamino]propyl]butanamide (PubChem CID 3619651) has the molecular formula C23H26Cl4N2O4 and a molecular weight of 536.28 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[2-[4-(2,4-dichlorophenoxy)butanoylamino]propyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[2-[4-(2,4-dichlorophenoxy)butanoylamino]propyl]butanamide |
|---|---|
| PubChem CID | 3619651 |
| Molecular Formula | C23H26Cl4N2O4 |
| Molecular Weight | 536.28 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[2-[4-(2,4-dichlorophenoxy)butanoylamino]propyl]butanamide |
| SMILES | CC(CNC(=O)CCCOc1ccc(Cl)cc1Cl)NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H26Cl4N2O4/c1-15(29-23(31)5-3-11-33-21-9-7-17(25)13-19(21)27)14-28-22(30)4-2-10-32-20-8-6-16(24)12-18(20)26/h6-9,12-13,15H,2-5,10-11,14H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | DNINHWSSPRZSKR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.28 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|