C15H21Cl2NO3 — CID 111447156
3-(2,4-dichlorophenoxy)-N-(4-hydroxy-2-methylpentyl)propanamide (PubChem CID 111447156) has the molecular formula C15H21Cl2NO3 and a molecular weight of 334.24 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)-N-(4-hydroxy-2-methylpentyl)propanamide.
| Compound Name | 3-(2,4-dichlorophenoxy)-N-(4-hydroxy-2-methylpentyl)propanamide |
|---|---|
| PubChem CID | 111447156 |
| Molecular Formula | C15H21Cl2NO3 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)-N-(4-hydroxy-2-methylpentyl)propanamide |
| SMILES | CC(O)CC(C)CNC(=O)CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2NO3/c1-10(7-11(2)19)9-18-15(20)5-6-21-14-4-3-12(16)8-13(14)17/h3-4,8,10-11,19H,5-7,9H2,1-2H3,(H,18,20) |
| InChIKey | KIHTXOJWOKOATO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |