C11H14Cl2N2O3 — CID 108880979
1-[(2,4-dichlorophenoxy)methyl]-3-(2-hydroxypropyl)urea (PubChem CID 108880979) has the molecular formula C11H14Cl2N2O3 and a molecular weight of 293.15 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenoxy)methyl]-3-(2-hydroxypropyl)urea.
| Compound Name | 1-[(2,4-dichlorophenoxy)methyl]-3-(2-hydroxypropyl)urea |
|---|---|
| PubChem CID | 108880979 |
| Molecular Formula | C11H14Cl2N2O3 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 1-[(2,4-dichlorophenoxy)methyl]-3-(2-hydroxypropyl)urea |
| SMILES | CC(O)CNC(=O)NCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O3/c1-7(16)5-14-11(17)15-6-18-10-3-2-8(12)4-9(10)13/h2-4,7,16H,5-6H2,1H3,(H2,14,15,17) |
| InChIKey | NQXWURGOLJKCET-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|