C14H12Cl2N2O3 — CID 108880931
1-[(2,4-dichlorophenoxy)methyl]-3-(2-hydroxyphenyl)urea (PubChem CID 108880931) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenoxy)methyl]-3-(2-hydroxyphenyl)urea.
| Compound Name | 1-[(2,4-dichlorophenoxy)methyl]-3-(2-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 108880931 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1-[(2,4-dichlorophenoxy)methyl]-3-(2-hydroxyphenyl)urea |
| SMILES | O=C(NCOc1ccc(Cl)cc1Cl)Nc1ccccc1O |
| InChI | InChI=1S/C14H12Cl2N2O3/c15-9-5-6-13(10(16)7-9)21-8-17-14(20)18-11-3-1-2-4-12(11)19/h1-7,19H,8H2,(H2,17,18,20) |
| InChIKey | VJPMDPKDPKVIPF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|