C10H12Cl2N2O2 — CID 108880980
1-[(2,4-dichlorophenoxy)methyl]-3-ethylurea (PubChem CID 108880980) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenoxy)methyl]-3-ethylurea.
| Compound Name | 1-[(2,4-dichlorophenoxy)methyl]-3-ethylurea |
|---|---|
| PubChem CID | 108880980 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 1-[(2,4-dichlorophenoxy)methyl]-3-ethylurea |
| SMILES | CCNC(=O)NCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O2/c1-2-13-10(15)14-6-16-9-4-3-7(11)5-8(9)12/h3-5H,2,6H2,1H3,(H2,13,14,15) |
| InChIKey | ZEJYZQPGBBKPFR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|