C12H16Cl2N2O2 — CID 108880884
1-tert-butyl-3-[(2,4-dichlorophenoxy)methyl]urea (PubChem CID 108880884) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2,4-dichlorophenoxy)methyl]urea.
| Compound Name | 1-tert-butyl-3-[(2,4-dichlorophenoxy)methyl]urea |
|---|---|
| PubChem CID | 108880884 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1-tert-butyl-3-[(2,4-dichlorophenoxy)methyl]urea |
| SMILES | CC(C)(C)NC(=O)NCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-12(2,3)16-11(17)15-7-18-10-5-4-8(13)6-9(10)14/h4-6H,7H2,1-3H3,(H2,15,16,17) |
| InChIKey | HLHSKLLTUDYHOV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|