C16H10Cl2F6N2O2 — CID 108881068
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2,4-dichlorophenoxy)methyl]urea (PubChem CID 108881068) has the molecular formula C16H10Cl2F6N2O2 and a molecular weight of 447.16 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2,4-dichlorophenoxy)methyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2,4-dichlorophenoxy)methyl]urea |
|---|---|
| PubChem CID | 108881068 |
| Molecular Formula | C16H10Cl2F6N2O2 |
| Molecular Weight | 447.16 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2,4-dichlorophenoxy)methyl]urea |
| SMILES | O=C(NCOc1ccc(Cl)cc1Cl)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10Cl2F6N2O2/c17-10-1-2-13(12(18)6-10)28-7-25-14(27)26-11-4-8(15(19,20)21)3-9(5-11)16(22,23)24/h1-6H,7H2,(H2,25,26,27) |
| InChIKey | XGVAJWMJNUOGBE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.16 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|