C15H13Cl3N2O2 — CID 108880889
1-[(4-chlorophenyl)methyl]-3-[(2,4-dichlorophenoxy)methyl]urea (PubChem CID 108880889) has the molecular formula C15H13Cl3N2O2 and a molecular weight of 359.64 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(2,4-dichlorophenoxy)methyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(2,4-dichlorophenoxy)methyl]urea |
|---|---|
| PubChem CID | 108880889 |
| Molecular Formula | C15H13Cl3N2O2 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(2,4-dichlorophenoxy)methyl]urea |
| SMILES | O=C(NCOc1ccc(Cl)cc1Cl)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13Cl3N2O2/c16-11-3-1-10(2-4-11)8-19-15(21)20-9-22-14-6-5-12(17)7-13(14)18/h1-7H,8-9H2,(H2,19,20,21) |
| InChIKey | RMXDZXWYRJYXDK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|